![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 1/ | 2022-12-21 07:10 | - | |
| AQAR_2019-20/ | 2024-08-31 15:58 | - | |
| AQAR_2020-21/ | 2024-09-05 16:59 | - | |
| AQAR_2021-22/ | 2024-09-05 18:12 | - | |
| AQAR_2022-23/ | 2024-09-05 18:56 | - | |
| AQAR_2023-24/ | 2024-09-04 19:29 | - | |
| AQAR_2024-25/ | 2024-10-04 12:13 | - | |
| Admission 23-24/ | 2023-04-12 10:21 | - | |
| Admissions2020-21/ | 2022-01-21 13:47 | - | |
| Admissions2021-22/ | 2022-03-01 04:08 | - | |
| Advertisement/ | 2024-04-20 06:30 | - | |
| Annual_Reports/ | 2022-03-01 04:28 | - | |
| BOM_BIODATA/ | 2022-03-01 04:37 | - | |
| BOQ for eTendring/ | 2023-12-18 11:46 | - | |
| DVV/ | 2024-09-01 07:38 | - | |
| DVV_old/ | 2024-09-04 21:00 | - | |
| Distribution_Transformer_OLTC/ | 2024-08-26 11:48 | - | |
| E-TENDERS FOR LABOUR RATE CONTRACT FOR NEW BUILDING CONSTRUCTION AND MAINTENANCE/ | 2023-07-01 07:54 | - | |
| E-TENDERS FOR SUPPLY RATE CONTRACT OF BUILDING CONSTRUCTION AND MAINTENANCE MATERIALS/ | 2023-07-01 08:14 | - | |
| E-Tender II for SUPPLY AND INSTALLATION OF FURNITURE & FIXTURES FOR 36 FLATS/ | 2022-10-12 09:50 | - | |
| E-Tender_CCTV/ | 2024-02-08 11:54 | - | |
| E-Tender_for_medical_equipment&Furniture/ | 2024-03-13 11:56 | - | |
| E-Tender_for_medicine/ | 2024-02-09 11:52 | - | |
| E-Tender for Desktop/ | 2024-02-01 06:18 | - | |
| E-Tender sept 2023/ | 2023-09-30 09:13 | - | |
| E-tender/ | 2024-02-06 10:33 | - | |
| ETENDER FOR DIODE LASER FOR GENERAL SURGERY & CO2 LASER FOR DERMATOLOGY./ | 2023-07-06 06:48 | - | |
| EposterCompetetion/ | 2020-06-16 11:10 | - | |
| EtenderMSCMedicalPhysics/ | 2024-06-21 10:06 | - | |
| HVAC_Ductable_split/ | 2024-08-12 08:00 | - | |
| LMS/ | 2023-11-07 07:29 | - | |
| MGM PG CET Result 2023-24/ | 2023-06-22 10:04 | - | |
| Mahindra_Bolero_and_Physiotherapy_Mobile_Van/ | 2024-08-17 11:59 | - | |
| NIRF2021/ | 2021-06-28 11:00 | - | |
| NIRF 2023/ | 2023-02-03 06:38 | - | |
| Notification-CET-2023-24/ | 2023-07-31 12:47 | - | |
| Notifications/ | 2022-02-28 18:30 | - | |
| Online Eligibility Form / | 2023-01-11 12:06 | - | |
| PO_CO/ | 2022-03-01 05:02 | - | |
| PhD_CET/ | 2022-05-27 09:44 | - | |
| QS I-Guage/ | 2024-09-18 08:01 | - | |
| Reports/ | 2022-03-01 04:20 | - | |
| School-of-Pharmacy/ | 2023-08-16 13:04 | - | |
| Statutory_approval_letters_for_professional_programmes/ | 2023-07-08 15:38 | - | |
| VAC/ | 2023-07-06 14:17 | - | |
| carrer/ | 2024-09-11 07:00 | - | |
| curriculum/ | 2022-02-28 18:30 | - | |
| e-Tender-23-Jan-2024/ | 2024-01-30 06:27 | - | |
| e-Tender-April-2023/ | 2023-05-26 12:35 | - | |
| e-Tender-Aug-2023/ | 2023-07-22 08:11 | - | |
| e-Tender-BOQ-2023/ | 2023-11-10 09:22 | - | |
| e-Tender-Dec-2021/ | 2021-12-22 07:38 | - | |
| e-Tender-Dec-2022/ | 2022-12-26 08:44 | - | |
| e-Tender-FEB-2023/ | 2023-02-24 05:37 | - | |
| e-Tender-Feb-2023/ | 2023-02-16 10:14 | - | |
| e-Tender-Jan-2022/ | 2023-01-20 09:15 | - | |
| e-Tender-Jan-2023/ | 2023-02-01 12:09 | - | |
| e-Tender-July-2022/ | 2022-07-25 10:08 | - | |
| e-Tender-July-2023/ | 2023-06-30 13:05 | - | |
| e-Tender-MAR-2023/ | 2023-03-16 09:47 | - | |
| e-Tender-May-2023/ | 2023-06-09 05:44 | - | |
| e-Tender-Nov-2022/ | 2022-11-11 06:55 | - | |
| e-Tender-Sep-2022/ | 2022-09-30 06:25 | - | |
| e-Tender-aug-2023/ | 2023-08-02 11:18 | - | |
| e-Tender_April_2023/ | 2023-04-20 08:34 | - | |
| e-Tender_ BOQ/ | 2023-05-07 13:35 | - | |
| e-Tender_Pharmacy/ | 2023-04-20 06:38 | - | |
| e-Tender for Firewall & Hardware Upgrade./ | 2024-07-24 12:59 | - | |
| e-tender-june-2022/ | 2022-07-01 11:43 | - | |
| e-tender for Rcc and Civil/ | 2024-02-20 11:27 | - | |
| eTender-Aug-2021/ | 2021-08-13 10:52 | - | |
| eTender-CCTV/ | 2021-08-31 09:45 | - | |
| eTender-RCC_and_Civil_Construction_work/ | 2024-02-20 11:24 | - | |
| eTender-for-Cranitomy- Instrument-Sets-and-Surgeon-Chair/ | 2024-10-14 07:33 | - | |
| eTender-for-Cranitomy-Instrument-Sets-and-Surgeon-Chair/ | 2024-10-14 07:37 | - | |
| eTender2/ | 2024-05-17 17:58 | - | |
| eTender_for_Desktops_with_Graphic_Card/ | 2024-09-06 10:11 | - | |
| eTender_for_ENT_Instruments_Set_General_Instruments_Dehumidifier_and_BLDC_Ceiling_Fans/ | 2024-09-06 10:00 | - | |
| eTender_for_Old_Vehicles_Disposable/ | 2024-09-06 09:30 | - | |
| eTender_for_Opthalmology_Equipments./ | 2024-10-11 07:52 | - | |
| eTender_for_Vehicle-XUV_700_&_Deep_Freezer-80°C/ | 2024-10-05 04:51 | - | |
| eTender for 100 KVA UPS/ | 2024-04-25 11:22 | - | |
| eTender for Aesthetic Surgery/ | 2024-06-12 08:14 | - | |
| eTender for Cardiac Surgery Instruments. / | 2024-06-03 11:23 | - | |
| eTender for Cholangioscope with Electrohydrolic Lithotripsy Machine and Stress Test Machine./ | 2024-04-29 08:25 | - | |
| eTender for Elevators Lifts/ | 2024-08-01 09:29 | - | |
| eTender for Green Laser for Ophthalmology./ | 2024-10-29 09:27 | - | |
| eTender for IT Server/ | 2024-07-08 08:22 | - | |
| eTender for Lab Equipment & Labware for MGM School of Pharmacy, Nerul. / | 2024-06-18 07:22 | - | |
| eTender for Live Events - Audio Video Sound Lights/ | 2024-07-31 12:33 | - | |
| eTender for Long Term Lease of Building/ | 2024-10-14 09:08 | - | |
| eTender for Operating Microscope./ | 2024-10-18 10:23 | - | |
| eTender for Pneumatic Lithotripter Machine, Fluorescent Microscope and Core Console Neurosurgery. / | 2024-05-10 11:46 | - | |
| eTender for Renewall of Firewall & Hardware (Appliance)/ | 2024-08-29 09:13 | - | |
| eTender for Surgical Disposable Products & Dressing Products/ | 2024-08-01 08:43 | - | |
| eTender for TMT Steel Steel Straight MAterial./ | 2024-08-31 10:51 | - | |
| eTender of Ortho OT Instruments Sets/ | 2023-08-25 10:57 | - | |
| etender-april-22/ | 2022-04-26 11:05 | - | |
| etender-march-22/ | 2022-03-22 10:38 | - | |
| etender/ | 2022-02-02 12:30 | - | |
| iqac/ | 2022-02-28 18:30 | - | |
| nirf2024/ | 2024-02-29 11:15 | - | |
| po-and-co/ | 2022-03-01 05:05 | - | |
| research/ | 2022-03-01 04:11 | - | |
| results/ | 2020-11-30 10:05 | - | |
| value added course/ | 2024-03-16 10:45 | - | |
| zebrafish-e-tender/ | 2021-11-22 07:36 | - | |
![[ ]](/icons/layout.gif) | NATIONAL RAGGING PREVENTION PROGRAMME.pdf | 2024-08-05 07:08 | 8.0K | |
| MeritList_Nursing1.pdf | 2019-07-12 04:12 | 16K | |
| CETResultMPTMScNursing&NPCC.pdf | 2019-07-04 04:17 | 17K | |
| CETResultBScNursing.pdf | 2019-07-04 04:17 | 19K | |
| MeritListPGNursing&MPT.pdf | 2019-07-16 11:49 | 19K | |
![[ ]](/icons/unknown.gif) | Home Page tender (2).docx | 2024-11-12 11:51 | 29K | |
| 20191015232116.pdf | 2019-10-16 05:56 | 36K | |
| Must read by Applicants.pdf | 2022-10-14 10:33 | 41K | |
| MGM-School-Nerul.pdf | 2020-11-04 06:04 | 42K | |
| Dental-College-Extn.Bldg..pdf | 2020-11-04 06:04 | 43K | |
| Student-Hostel-Bldg.Kharghar.pdf | 2020-11-04 06:04 | 45K | |
| Home Page tender (1).pdf | 2024-11-06 13:55 | 53K | |
| 04 Application - Permission for Submission of Papers for Publication or Presentation in Conferences.pdf | 2024-08-31 08:04 | 53K | |
| 06 Application Form For Examinership.pdf | 2024-08-31 08:08 | 53K | |
| Home Page tender (2) (1).pdf | 2024-11-18 10:44 | 54K | |
| Home Page tender 2.pdf | 2024-11-11 06:01 | 55K | |
| 05 Application for Financial Support to Participate in Conference or Workshop.pdf | 2024-08-31 08:06 | 58K | |
| ARIIA_REPORT_2021.pdf | 2021-10-08 08:38 | 60K | |
| Home Page tender (1) (1).pdf | 2024-11-18 10:39 | 61K | |
| Home Page tender (1)(1).pdf | 2024-11-18 08:41 | 61K | |
| Home Page tender (2).pdf | 2024-11-12 12:00 | 63K | |
| Self Declaration form for non availability of documents.pdf | 2020-12-29 11:24 | 64K | |
| MeritList_BPT.pdf | 2019-07-15 12:19 | 66K | |
| Medical-College.pdf | 2020-11-04 06:04 | 66K | |
| CETResultBPT.pdf | 2019-07-04 04:17 | 71K | |
| Appliation for Migration Certificate.pdf | 2020-04-18 14:34 | 74K | |
| ApplicationforDuplicateUniversityCertificate.pdf | 2024-08-31 08:15 | 74K | |
| Online Plagiaism Check.pdf | 2024-08-31 07:50 | 75K | |
| Formate of Application for permission for Guide Change.pdf | 2024-08-31 07:59 | 78K | |
| Application form for verification of University Documents.pdf | 2024-05-28 10:24 | 78K | |
| Authority Letter.pdf | 2024-08-31 07:57 | 78K | |
| Application for Attestation of University documents-Photocopies only2.pdf | 2024-05-28 10:24 | 81K | |
| Application for University Internship Completion Certificate.pdf | 2024-05-23 06:36 | 81K | |
| Application for Internship Completion Certificate.pdf | 2024-05-23 06:41 | 81K | |
| ADVERTISEMENT.pdf | 2024-08-30 05:13 | 84K | |
| Career.pdf | 2024-08-30 05:14 | 84K | |
| Appliation4UndertakingInLieuOfDegreeCertificate.pdf | 2021-06-07 11:57 | 84K | |
| CETMarksVerificationForm.pdf | 2019-07-04 08:50 | 88K | |
| category-B.pdf | 2020-11-27 04:48 | 88K | |
| Appliation4UndertakingInLieuOfDegreeCertificate07_2020.pdf | 2020-07-23 07:18 | 91K | |
| 2. ICU and OT Pendants.pdf | 2022-04-26 10:53 | 92K | |
| ApplicationforInternshipCompletionCertificate.pdf | 2020-02-13 13:00 | 92K | |
| 1. Color Doppler USG Machine.pdf | 2022-04-27 11:11 | 92K | |
| Appliation_form_for_University_NOC_for_Internship_Transfer.pdf | 2021-05-11 07:26 | 94K | |
| M.Sc. Medical Schedule .pdf | 2022-06-04 12:37 | 94K | |
| B.Sc. AHS Schedule.pdf | 2022-06-04 12:37 | 94K | |
| M.Sc. AHS Schedule.pdf | 2022-06-04 12:37 | 95K | |
| Format-for-registration-of-Placement.pdf | 2020-03-11 11:33 | 95K | |
| ApplForInternshipCompletionCertificateV06_2020.pdf | 2020-06-12 12:08 | 97K | |
| Appliation for Migration Certificate23.05.2024.pdf | 2024-05-29 06:37 | 103K | |
| RTI Declaration.pdf | 2019-12-17 05:39 | 104K | |
| Notification195_2020.pdf | 2020-09-22 10:41 | 106K | |
| Notification197_2020.pdf | 2020-09-22 10:41 | 110K | |
| ApplicationForChangeOrCorrectionInUniversityCertificate.pdf | 2023-10-27 11:20 | 112K | |
| ApplicationforAttestationofUniversitydocuments_PhotocopiesOnlyOld.pdf | 2024-08-31 08:16 | 114K | |
| IIQA.pdf | 2022-08-22 07:19 | 116K | |
| M.Sc Health Informatics.pdf | 2024-08-06 07:27 | 116K | |
| Notification196_2020.pdf | 2020-09-22 10:41 | 117K | |
| List_of_UG_Program_Campus_wise.pdf | 2021-09-16 07:32 | 117K | |
| SOPforRevaluationofAnswerBooks.pdf | 2019-08-10 07:18 | 119K | |
| ApplicationforAttestationofUniversitydocuments_PhotocopiesOnly.pdf | 2020-09-22 10:17 | 121K | |
| Notification128_2020.pdf | 2020-07-10 11:58 | 124K | |
| IQAC Composition 2021-22.pdf | 2023-03-01 10:24 | 128K | |
| List_of_Fellowship_Program.pdf | 2021-12-01 09:58 | 129K | |
| NAAC Certificate of Accreditation.pdf | 2024-03-29 12:19 | 130K | |
| Notification-Placement_cell.pdf | 2020-03-11 11:36 | 130K | |
| Application for Duplicate University Certificate 10_2018.pdf | 2024-08-31 08:12 | 131K | |
| Graduate_Attributes.pdf | 2021-04-01 12:38 | 132K | |
| 09 Application for Ph D Guide Recognition.pdf | 2024-08-31 08:09 | 133K | |
| Application for Passing Certificate.pdf | 2024-05-28 10:24 | 133K | |
| Notification123_2020.pdf | 2020-06-27 09:08 | 135K | |
| Advert4SpinePhD_30.06.2020.pdf | 2020-07-06 09:24 | 136K | |
| 7. Isolation Panel.pdf | 2022-04-26 10:53 | 136K | |
| Code of Conduct for MGMIHS and its Institution's Employees.pdf | 2024-01-05 07:00 | 138K | |
| Vehicle - Bus 30 Seater (1).pdf | 2024-11-11 05:53 | 138K | |
| List_of_VAC_.pdf | 2021-08-23 07:24 | 139K | |
| E-Tender.pdf | 2021-03-03 05:15 | 140K | |
| NotificationNo75-2020.PDF | 2020-03-04 06:12 | 143K | |
| List_of_Fellowship_Program_old-17-07-2021.pdf | 2021-05-31 12:26 | 144K | |
| RTI Declaration_old.pdf | 2019-11-07 05:57 | 150K | |
| Notification130_2020.pdf | 2020-07-18 11:11 | 152K | |
| Notification175_2019.pdf | 2019-09-24 05:21 | 153K | |
| Green Laser for Ophthal.pdf | 2024-10-29 09:23 | 154K | |
| 11. Expansion Joint.pdf | 2022-04-27 11:11 | 154K | |
| Notification149_2019.pdf | 2019-08-19 12:32 | 154K | |
| PG_Program_Code_list.pdf | 2021-06-18 08:46 | 155K | |
| NotificationNo76-2020.PDF | 2020-03-04 06:12 | 157K | |
| 1. Addvertisement.pdf | 2021-04-03 09:57 | 163K | |
| Notification No. 192_2020.pdf | 2020-09-16 04:37 | 166K | |
| E-tender-lifts.pdf | 2020-11-04 06:20 | 179K | |
| Notification No. 49_2020.pdf | 2020-09-10 12:36 | 181K | |
| Notification-No-181-2019.pdf | 2019-10-02 04:58 | 181K | |
| IQAC Meeting room.pdf | 2023-01-19 10:53 | 183K | |
| Notification No. 172_2020.pdf | 2020-09-01 10:27 | 190K | |
| Notification172_2020.pdf | 2020-09-01 12:09 | 190K | |
| Notification No. AC-48_2020.pdf | 2020-08-17 11:22 | 193K | |
| CET2020Notification.pdf | 2020-06-10 09:28 | 194K | |
| ApplSubmissionExtensionNotification_11Convocation.pdf | 2019-07-15 12:19 | 207K | |
| Notification124_19.pdf | 2019-07-28 18:47 | 212K | |
| Notification123_19.pdf | 2019-07-28 18:47 | 214K | |
| notificationNo239-2020.pdf | 2020-11-26 07:42 | 214K | |
| Notification47_2020.pdf | 2020-02-18 12:02 | 214K | |
| 4. Pneumatic Tube System.pdf | 2022-04-27 11:11 | 215K | |
| notificationNo113-2019.pdf | 2019-07-11 09:48 | 216K | |
| First MBBS Re-verification Result Sept 2024 Vashi.pdf | 2024-10-30 11:32 | 217K | |
| MF31072019PhDdegreeAwardeddetailstillXConv.pdf | 2019-08-12 10:35 | 218K | |
| Notification48_2020.pdf | 2020-02-18 12:02 | 218K | |
| M.Sc Nursing Programme.pdf | 2024-08-06 07:54 | 221K | |
| P.B.B.Sc Nursing Programme.pdf | 2024-08-06 07:54 | 221K | |
| B.Sc Nursing Programme.pdf | 2024-08-06 07:54 | 226K | |
| Notification191_2019.pdf | 2019-10-22 07:52 | 226K | |
| M.Sc Nursing NPCC.pdf | 2024-08-06 07:54 | 227K | |
| Cautionary-Notice.pdf | 2020-03-02 11:46 | 227K | |
| Notification103_2020.pdf | 2020-06-01 07:37 | 235K | |
| CET Question paepr details.pdf | 2023-07-31 12:17 | 244K | |
| First MBBS Re-verification Result Sept 2024 Kamothe.pdf | 2024-10-30 11:32 | 246K | |
| AcademicCalender2021-22_.pdf | 2021-06-11 11:56 | 247K | |
| List_of_VAC.pdf | 2024-03-16 10:49 | 249K | |
| 254-Notification.pdf | 2020-12-19 10:04 | 257K | |
| Notification113_2019.pdf | 2019-07-17 08:15 | 258K | |
| APPLICATION FORM FOR VERIFICATION OF MARKS (MGM-CET-2023).pdf | 2023-06-22 11:55 | 259K | |
| APPLICATION FORM FOR VERIFICATION OF MARKS (MGM-CET-2024).pdf | 2024-07-30 13:06 | 259K | |
| List_of_VAC(OLD).pdf | 2023-08-10 08:35 | 261K | |
| 253-Notification.pdf | 2020-12-19 10:04 | 262K | |
| Disclaimer.pdf | 2022-05-12 09:47 | 267K | |
| TENDER DOCUMENT.pdf | 2024-11-12 11:51 | 268K | |
| Fire Protection System (Updating Existing System).pdf | 2024-11-06 13:45 | 268K | |
| notification232-2020.pdf | 2020-11-06 05:27 | 273K | |
| 10. Flooring - Vinyl and Wall Flex.pdf | 2022-04-26 10:53 | 277K | |
| Ph.D Thesis Defense Result -Mr. Prashant Kulkarni.pdf | 2023-10-26 06:28 | 278K | |
| scan0001.pdf | 2019-07-23 06:03 | 280K | |
| Notification141_2019.pdf | 2019-08-10 06:01 | 283K | |
| 5. MATV System.pdf | 2022-04-26 10:53 | 289K | |
| Notification No.55_2020.pdf | 2020-11-18 11:51 | 289K | |
| Web Policy.pdf | 2022-05-12 09:47 | 291K | |
| Poonam Desai.pdf | 2024-08-14 11:31 | 292K | |
| Rahul Deshmukh.pdf | 2024-08-05 07:04 | 292K | |
| Notification128_2019.pdf | 2019-08-10 06:01 | 293K | |
| MGMIHS 20th Convocation.pdf | 2024-08-19 05:29 | 293K | |
| MGMIHS_20th_Convocation.pdf | 2024-08-19 05:25 | 293K | |
| 6. Data & Telephone System.pdf | 2022-04-26 10:53 | 295K | |
| 8. Hospital Furniture.pdf | 2022-04-27 11:11 | 295K | |
| notificationNo112-2019.pdf | 2019-07-11 06:49 | 295K | |
| NIRF 2022 Medical.pdf | 2022-03-02 08:38 | 298K | |
| E-Tendering-for-Passenger-Elevators(Lifts).pdf | 2020-11-04 07:58 | 298K | |
| Notification No. AC-52_2020.pdf | 2020-11-04 12:58 | 300K | |
| Notification28_2019.pdf | 2019-07-06 11:31 | 302K | |
| Career(old).pdf | 2021-10-29 06:28 | 305K | |
| notificatoion237-2020.pdf | 2020-11-18 11:08 | 305K | |
| Notification126_2019.pdf | 2019-08-02 07:53 | 306K | |
| Notification181_2019.pdf | 2019-10-04 13:17 | 311K | |
| IQACMinutes041119.pdf | 2020-03-05 04:35 | 311K | |
| Notification-No.53_2020(Admission-to-Ph.D-program-2020-21).pdf | 2020-11-06 09:50 | 314K | |
| NIRF 2022 Overall.pdf | 2022-03-02 08:38 | 314K | |
| Ph.D Thesis defense -Ms. Pooja Sharma.pdf | 2023-06-24 12:45 | 318K | |
| Result Shruti Bhovad.pdf | 2024-08-07 11:17 | 319K | |
| Notification42_2020.pdf | 2020-02-10 09:53 | 319K | |
| notificationNo242-2020.pdf | 2020-12-02 09:31 | 321K | |
| Notification No 35-Institute level offline Mop Up Round.pdf | 2019-08-27 13:09 | 321K | |
| Notification37_2020.pdf | 2020-01-14 05:51 | 321K | |
| Ph.D Thesis defense -Ms. Akankhsa Chauhan.pdf | 2023-06-24 12:45 | 322K | |
| Final_DVV Clarifications_25-06-2022.pdf | 2022-08-22 07:36 | 329K | |
| Notification08_2020.pdf | 2020-01-15 11:58 | 330K | |
| MGM Institute of Health Sciences, Navi Mumbai20210226-.pdf | 2022-02-04 12:53 | 334K | |
| GrievanceSOP.pdf | 2019-07-03 09:32 | 335K | |
| Notification14_2020.pdf | 2020-01-15 11:59 | 339K | |
| Notification116_2019.pdf | 2019-07-20 11:52 | 339K | |
| Notification230_2019.pdf | 2019-12-07 11:55 | 345K | |
| MGM Institute of Health Sciences, Navi Mumbai20210226- (1).pdf | 2022-02-04 12:51 | 350K | |
| MGM Institute of Health Sciences, Navi Mumbai20210226-overall (1).pdf | 2022-02-04 12:53 | 350K | |
| MPTCounselling1stRound2019.pdf | 2019-07-17 16:06 | 352K | |
| Notification No. AC-42_2020.pdf | 2020-07-09 12:51 | 352K | |
| Notification117_2019.pdf | 2019-07-20 11:52 | 354K | |
| Notification229_2019.pdf | 2019-12-07 11:55 | 355K | |
| notificationNo129-2019.pdf | 2019-08-05 10:04 | 356K | |
| UG CET notification 2022.pdf | 2022-08-02 06:05 | 357K | |
| Notification01_2020.pdf | 2020-01-06 08:57 | 358K | |
| NIRF2019_Medical.pdf | 2022-02-04 12:43 | 359K | |
| NIRF2019_Overall.pdf | 2022-02-04 12:43 | 367K | |
| MGM- UG-CET-2023 B.Pharm ,D.Pharm , B.Sc Nursing additional seats&BPO.pdf | 2023-07-31 12:17 | 367K | |
| Notification243_2019.pdf | 2019-12-19 10:10 | 370K | |
| finalunivexamschedule.pdf | 2020-12-14 08:38 | 372K | |
| NEET-UG_&_PG,_Superspeciality.pdf | 2021-05-05 09:29 | 373K | |
| Notification231_2019.pdf | 2019-12-09 04:39 | 374K | |
| Notification13_2020.pdf | 2020-01-15 11:58 | 376K | |
| Notification245_2019.pdf | 2019-12-19 10:10 | 379K | |
| Notification92_2020.pdf | 2020-03-18 12:12 | 379K | |
| Notification253_2019.pdf | 2020-01-03 12:32 | 383K | |
| Notification40_2020.pdf | 2020-02-10 09:53 | 386K | |
| MF19_8_2019FinalPhDstudentsList.pdf | 2019-10-05 05:32 | 386K | |
| All_Report-MHRD_National_Institutional_Ranking_Framework(NIRF-Medical).pdf | 2022-02-04 12:37 | 387K | |
| NIRF2020_Medical.pdf | 2022-02-04 12:44 | 387K | |
| Notification136_2019.pdf | 2019-08-10 06:01 | 388K | |
| Pharmacy Notification.pdf | 2024-09-26 11:53 | 389K | |
| Notificattion173_2020.pdf | 2020-09-03 09:29 | 391K | |
| Notification119_2020.pdf | 2020-06-23 11:04 | 393K | |
| List_of_VAC(old).pdf | 2021-11-25 09:03 | 394K | |
| All_Report-MHRD_National_Institutional_Ranking_Framework(NIRF-Overall).pdf | 2022-02-04 12:37 | 395K | |
| 3. A) HVAC System.pdf | 2022-04-26 10:56 | 395K | |
| Notification75_2020.pdf | 2020-03-05 12:14 | 398K | |
| Notification116_2020.pdf | 2020-06-12 10:38 | 398K | |
| NIRF2020_Overall.pdf | 2022-02-04 12:44 | 398K | |
| Notification02_2020.pdf | 2020-01-06 08:57 | 402K | |
| Notification41_2020.pdf | 2020-02-10 09:53 | 403K | |
| Poonam Desai Thesis Defense.pdf | 2024-08-03 09:27 | 404K | |
| 12thConvocationNotification.pdf | 2019-12-14 08:41 | 405K | |
| Notification76_2020.pdf | 2020-03-05 12:14 | 412K | |
| Notification78_2020.pdf | 2020-03-06 12:03 | 413K | |
| Notification189_2019.pdf | 2019-10-22 08:02 | 415K | |
| MGMPhDCET2019Result.pdf | 2019-07-25 12:03 | 416K | |
| UG_PG Teacher Recognition 07-06-2024.pdf | 2024-06-10 06:16 | 416K | |
| Notification117_2020.pdf | 2020-06-12 10:38 | 419K | |
| Notification219_2019.pdf | 2019-11-28 10:31 | 422K | |
| Notification244_2019.pdf | 2019-12-19 10:10 | 423K | |
| SOP-to-Conduct-MGM-CET-During-Covid-19.pdf | 2020-10-23 08:40 | 427K | |
| Ph.D CET 2024 Presentation and Viva-Voce examination Notification.pdf | 2024-07-30 12:52 | 432K | |
| Notification236_2019.pdf | 2019-12-14 07:39 | 433K | |
| coc-faculty.pdf | 2021-03-16 11:07 | 433K | |
| Notification26_2020.pdf | 2020-01-28 12:03 | 435K | |
| MPT Merit CET list 2023.pdf | 2023-06-29 06:00 | 441K | |
| Canellation policy_Post Basic B.Sc. Nursing.pdf | 2022-07-26 08:52 | 442K | |
| Notification101_2019PhD.pdf | 2019-07-17 08:07 | 445K | |
| Notification220_2019.pdf | 2019-11-29 12:06 | 464K | |
| Notification222_2019.pdf | 2019-11-30 11:49 | 470K | |
| PhDOrdinance632020.pdf | 2021-01-08 08:01 | 478K | |
| Notification159A_2020.pdf | 2020-09-03 09:40 | 481K | |
| Technical Specification.pdf | 2024-11-18 10:41 | 481K | |
| New Trader,Rich Trader 2_ Good Trades, Bad Trades ( PDFDrive ) (1).mobi | 2022-12-04 04:55 | 483K | |
| Notification137_2019.pdf | 2019-08-08 06:04 | 483K | |
| coc-student.pdf | 2021-03-16 11:07 | 501K | |
| PhD- Admission Brochure 2024-25 Revised.pdf | 2024-10-23 12:17 | 501K | |
| Notification159_2020.pdf | 2020-08-25 11:35 | 502K | |
| Notification87_2020.pdf | 2020-03-11 11:45 | 504K | |
| NotificationAdmissionCounsellingBPO.pdf | 2019-07-26 12:15 | 511K | |
| Notification No. AC-51_2020.pdf | 2020-11-04 12:48 | 516K | |
| Notifiation No.AC-54-2020.pdf | 2020-11-11 10:06 | 518K | |
| iii. Special Conditions.pdf | 2024-11-18 07:55 | 519K | |
| 3.1.5 Prosthetic Orthotic Lab and Machine room Facility at MGMIUDPO WITH GEOTAG PHOTO.pdf | 2022-03-21 10:46 | 538K | |
| Auditorium room.pdf | 2023-01-19 10:53 | 541K | |
| IQACMinutes121119.pdf | 2020-03-05 04:35 | 543K | |
| Updated MoA of MGMIHS, NM (Approved as per BOM-63-2021 dt.17.02.2021.pdf | 2024-02-29 12:41 | 548K | |
| BPO Cancellation Policy.pdf | 2023-07-05 09:05 | 551K | |
| PhD Ordinance amendment 22.6.2020_old.pdf | 2020-07-13 08:12 | 553K | |
| Notification130_2019.pdf | 2019-08-07 12:16 | 553K | |
| NotificationAC29_2019_AdmissionCounselingBSc_N.pdf | 2019-07-12 04:12 | 554K | |
| BPTCounsellingIstRound2019.pdf | 2019-07-16 07:07 | 554K | |
| 25220PhDAwarded1stJuly2014to30thJune2019.pdf | 2020-02-26 06:43 | 573K | |
| 3. B) LOWER SIDE HVAC System..pdf | 2022-04-26 10:53 | 581K | |
| Inflibnet flyerMerged230819.pdf | 2019-08-23 11:52 | 583K | |
| ApplicationtoPursueObservershipShortTermTraining.pdf | 2020-03-03 09:46 | 586K | |
| notificatio217.pdf | 2020-10-15 10:13 | 610K | |
| Inflibnet Prg Final 3.pdf | 2019-08-21 06:13 | 626K | |
| VacancyAdvertisementMGMSOPNM.pdf | 2019-11-13 12:16 | 655K | |
| IQAC_Minutes_27th_April_2019.pdf | 2019-08-23 12:56 | 658K | |
| Career_.pdf | 2020-11-21 15:59 | 660K | |
| List_of_VAC__.pdf | 2020-12-29 13:55 | 675K | |
| Notification26_2019.pdf | 2019-07-02 10:59 | 679K | |
| Mgm-BPT_CET-2020-Result-&-Counselling-Schedule.pdf | 2020-10-28 09:01 | 688K | |
| MGM-MPT-CET-2020.pdf | 2020-10-09 11:26 | 700K | |
| MGM-BPT-CET.pdf | 2020-10-09 11:26 | 707K | |
| CET_Details.pdf | 2021-06-04 09:07 | 725K | |
| Circular_Value_Added_Courses(old).pdf | 2020-12-29 14:05 | 745K | |
| Circular_Value_Added_Courses.pdf | 2022-10-07 12:30 | 745K | |
| MGM-PHD-CET-2020.pdf | 2020-10-09 11:26 | 761K | |
| presentation-and-viva-voce-examination.pdf | 2020-10-23 09:39 | 764K | |
| MGMIHS_Guidelines_Final.pdf | 2020-11-16 09:14 | 782K | |
| declaration-result-of-DM-and-MCh-Examination-Sept2020.pdf | 2020-09-16 07:19 | 800K | |
| 08 Application for PG Teacher Recognition.pdf | 2023-12-22 09:25 | 802K | |
| VIEWS.pdf | 2024-11-12 11:51 | 808K | |
| ii. General Terms & Conditions.pdf | 2024-11-18 07:55 | 820K | |
| Notification209_2019.pdf | 2019-11-13 11:15 | 822K | |
| Notification verification of Marks.pdf | 2024-08-03 09:27 | 823K | |
| NEP2020.pdf | 2020-09-01 05:24 | 824K | |
| Cancellation Policy_M.Sc. Medical_2022-23.pdf | 2022-06-08 10:39 | 841K | |
| Final 30.5.22 PhD- Admission Brochure 2022-23.pdf | 2022-06-02 11:22 | 849K | |
| PhD- Admission Brochure 2022-23 (5).pdf | 2022-06-02 11:26 | 849K | |
| PhD-Admission_Brochure_2022-23_Revised.pdf | 2022-06-07 04:59 | 853K | |
| Schedule of Merit list_Post Basic B.Sc. Nursing.pdf | 2022-07-26 08:54 | 854K | |
| Notification207_2019.pdf | 2019-11-13 11:15 | 872K | |
| IQACMinutes20112020.pdf | 2020-12-05 10:55 | 873K | |
| Instruction for 16th Convocation.pdf | 2022-07-18 09:26 | 882K | |
| vi. HVAC Work for Belapur.pdf | 2024-11-18 07:55 | 896K | |
| fellowship result.pdf | 2024-09-24 11:04 | 898K | |
| Notification11_2020.pdf | 2020-01-16 13:11 | 900K | |
| i. Technical Specifications & Approved Makes.pdf | 2024-11-18 07:55 | 905K | |
| PhD- Admission Brochure 2022-23.pdf | 2022-04-28 06:24 | 921K | |
| Notification80_2020.pdf | 2020-03-07 12:04 | 926K | |
| Notification43_2020.pdf | 2020-02-11 10:02 | 935K | |
| Notification39_2020.pdf | 2020-02-07 11:23 | 942K | |
| NotificationAC33_2019.pdf | 2019-07-23 05:40 | 943K | |
| Revised Academic Calendar for 2020-21 (AC-482023).pdf | 2024-03-29 12:31 | 964K | |
| Cancellation Policy_B.Sc. AHS & M.Sc. AHS Master's Programmes_2022-23.pdf | 2022-06-08 10:41 | 1.0M | |
| PhDOrdinance.pdf | 2022-10-04 10:07 | 1.0M | |
| 17th Convocation Notification 2023.pdf | 2023-01-25 11:52 | 1.0M | |
| PhD Ordinance amendment 22.6.2020.pdf | 2020-09-22 11:05 | 1.0M | |
| PhD- Admission Brochure 2024-25 (1).pdf | 2024-05-02 10:47 | 1.1M | |
| Revised Academic Calender 2019-20.pdf | 2023-01-13 07:01 | 1.1M | |
| PhD- Admission Brochure 2024-25 (2).pdf | 2024-06-25 09:58 | 1.1M | |
| SGRC SOP version III.pdf | 2024-11-11 05:40 | 1.1M | |
| Final 4.5.22 PhD- Admission Brochure 2022-23.pdf | 2022-05-05 06:05 | 1.1M | |
| Notification124_2020.pdf | 2020-07-06 07:41 | 1.1M | |
| MBBS 20-21 notification.pdf | 2020-11-30 11:26 | 1.1M | |
| Instruction for 20th Convocation.pdf | 2024-09-13 04:52 | 1.1M | |
| MGM-CET-2020.pdf | 2020-10-03 08:03 | 1.1M | |
| iv-PATIENT-FLOORS-8TH-TO-11TH-HVAC-Layout-Typical-TYP-PATIENT-FLOOR-HVAC-LAYOUT.pdf | 2024-11-18 07:55 | 1.2M | |
| Notification29_2020.pdf | 2020-01-30 05:36 | 1.2M | |
| GrievanceSOPv1.pdf | 2024-02-26 08:16 | 1.3M | |
| Ph.D CET -2024 Result.pdf | 2024-08-17 11:41 | 1.3M | |
| MGM-UG&PG-CET.pdf | 2020-10-03 08:03 | 1.5M | |
| v-MGM-BELAPUR-CHW-SCHEMATIC-8th-to-11th-floors-CHW-PIPE-SCHEMATIC.pdf | 2024-11-18 07:55 | 1.5M | |
| Revised Academic Calendar for 2019-20 (AC-482023).pdf | 2024-03-29 12:32 | 1.5M | |
| PhDGuideList26072019.pdf | 2019-07-28 18:47 | 1.5M | |
| MPT CET 2024 Result.pdf | 2024-07-30 13:06 | 1.5M | |
| Incubation&InnovationCentre.pdf | 2022-03-30 06:39 | 1.6M | |
| Instruction for Candidates attending 18th Convocation.pdf | 2023-08-18 04:15 | 1.6M | |
| Revised Academic Calendar for 2021-22 (AC-482023).pdf | 2024-03-29 12:29 | 1.6M | |
| MGMNBCON - 3.1.5 - Geotagged photos of all labs-Copy.pdf | 2022-03-21 11:29 | 1.7M | |
| 9. B) Drawing.pdf | 2022-04-26 10:53 | 1.7M | |
| PhD GuideList Sept2020.pdf | 2020-09-01 05:51 | 1.9M | |
| PhDGuides-20200901.pdf | 2020-11-09 09:46 | 1.9M | |
| MBBS 20-21 notification_.pdf | 2020-10-29 14:01 | 1.9M | |
| Eligibility Notice Outward No 961_2023..pdf | 2023-10-10 09:16 | 1.9M | |
| AcademicCalender2019-20_.pdf | 2020-01-27 12:03 | 2.0M | |
| Notification30_2020.pdf | 2020-01-30 05:36 | 2.0M | |
| IQAC_Minutes_20th_April_2019.pdf | 2019-08-23 12:56 | 2.0M | |
| Notification-57.pdf | 2021-01-08 01:41 | 2.0M | |
| Rules&RegulationForExamination.pdf | 2019-08-10 07:13 | 2.1M | |
| MGM Ph.D. Admission Counseling 2024-25 Notification No. AC-100-2024 (1).pdf | 2024-08-19 12:08 | 2.1M | |
| Cautinary Notice.pdf | 2023-07-17 10:28 | 2.1M | |
| Minutes of the IQAC Meeting 2014.pdf | 2019-12-17 10:51 | 2.2M | |
| IQAC_Minutes_18th_December_2018.pdf | 2019-08-23 12:56 | 2.3M | |
| 2.Tender_document_MGM_Hospital-Aurangabad.pdf | 2021-04-03 09:57 | 2.3M | |
| IQAC_Minutes_06th_July_2018.pdf | 2019-08-23 12:56 | 2.4M | |
| Notification No. 96_2024_BPT.pdf | 2024-08-05 10:46 | 2.5M | |
| Masters_of_Science_(Clinical_Nutrition)(CBCS)_wef_2024_25_batch (1).pdf | 2024-09-25 11:33 | 2.5M | |
| MGM-MPT-CET-2024 Merit List.pdf | 2024-08-03 09:40 | 2.5M | |
| DM MCh Notification No.73_2022.pdf | 2022-07-27 05:55 | 2.6M | |
| Academic Calender 2023-24.pdf | 2023-06-24 12:05 | 2.7M | |
| Notification No. 97_2024_MPT.pdf | 2024-08-05 10:46 | 2.7M | |
| Notification No. 56_2020.pdf | 2020-12-04 07:17 | 2.8M | |
| 9. A) 300 Capacity Step Lecture Hall Building Construction.pdf | 2022-04-26 10:53 | 2.8M | |
| IQACMinutes17072019.pdf | 2020-03-05 04:35 | 2.8M | |
| Re-Evaluation Result.pdf | 2024-09-16 05:32 | 2.8M | |
| NotificationAC41_2020.pdf | 2020-06-08 11:17 | 2.9M | |
| AcademicCalender2017-18.pdf | 2019-08-23 13:22 | 3.1M | |
| 3. Drawing.pdf | 2021-04-03 09:57 | 3.3M | |
| AcademicCalender2018-19.pdf | 2020-01-27 12:03 | 3.3M | |
| IQAC_Minutes_08th_October_2018.pdf | 2019-08-23 12:56 | 3.5M | |
| Minutes of the IQAC meeting 2015.pdf | 2019-12-17 10:51 | 3.6M | |
| IQACMeetings17072019.pdf | 2021-04-09 12:36 | 3.6M | |
| Nutricon 2019 v2.pdf | 2019-08-03 06:05 | 3.7M | |
| Notification245-2020.PDF | 2020-12-17 10:45 | 3.7M | |
| Revised Academic Calendar for 2022-23 (AC-482023).pdf | 2024-03-29 12:25 | 4.2M | |
| PhDfinalStudentsListNov2019.PDF | 2019-11-06 09:47 | 4.2M | |
| MGM UG CET 2023 RESULT.pdf | 2023-06-21 12:58 | 4.7M | |
| Revised_Academic_Calender_2021-22.pdf | 2023-02-10 11:26 | 4.9M | |
| PhDScholars_.pdf | 2020-10-19 09:12 | 4.9M | |
| Notification 56_Revised_Final.pdf | 2020-12-21 07:58 | 5.0M | |
| Academic Calender(2020-21).pdf | 2022-05-06 11:13 | 5.1M | |
| AcademicCalender2020-21.pdf | 2022-05-06 11:22 | 5.1M | |
| AcademicCalender2014-15.pdf | 2019-08-23 13:21 | 5.1M | |
| Prospectus_Ph.D 2021-22.pdf | 2021-08-10 10:55 | 5.3M | |
| Revised Academic Calender 2020-21.pdf | 2023-01-13 07:10 | 6.1M | |
| BPT CET 2024 Result.pdf | 2024-07-30 13:06 | 6.2M | |
| AcademicCalender2015-16.pdf | 2019-08-23 13:21 | 6.3M | |
| Rules&RegulationAllMattersExamination.pdf | 2021-10-18 05:29 | 7.6M | |
| AcademicCalender2013-14.pdf | 2019-08-23 13:21 | 7.8M | |
| Architecture Drawings.pdf | 2024-11-12 11:51 | 8.5M | |
| DM MCh Notification No. 93_2023.pdf | 2023-11-08 09:26 | 8.9M | |
| Structure Drawings.pdf | 2024-11-12 11:51 | 9.1M | |
| Revised_Academic_Calender_2023_24.pdf | 2024-02-29 10:54 | 11M | |
| PhDScholars.pdf | 2021-10-06 06:12 | 11M | |
| Academic Calender 2024-25.pdf | 2024-07-24 11:32 | 11M | |
| The New Trading for a Living_ Psychology, Discipline, Trading Tools and Systems, Risk Control, Trade Management (Wiley Trading) ( PDFDrive ).mobi | 2022-12-04 04:55 | 11M | |
| AcademicCalender2019-20.pdf | 2021-06-17 11:40 | 12M | |
| MGM-BPT-CET-2024 Merit List.pdf | 2024-08-03 09:40 | 13M | |
| INC_Certificates_final.pdf | 2020-01-23 09:57 | 14M | |
| Revised Academic Calender_2022-23.pdf | 2023-01-09 13:00 | 17M | |
| Academic Calender 2022-23.pdf | 2022-05-17 11:06 | 17M | |
| Revised Academic Calender_2022-23NEW.pdf | 2023-02-17 11:34 | 17M | |
| Academic_Calender_2022-23.pdf | 2022-06-23 17:10 | 19M | |
| AcademicCalender2021-22.pdf | 2021-11-11 10:56 | 22M | |
| MGMIHS-Annual-report_2018-19.pdf | 2020-04-08 12:46 | 29M | |
| Final MGMIHS Anual Report 2022-23.pdf | 2024-07-10 07:47 | 36M | |
| MGMIHS ANNUAL REPORT 2021-22.pdf | 2024-02-17 10:28 | 42M | |
| Code Of Conduct.pdf | 2022-09-30 07:49 | 43M | |
| Download-PHRD-English-Print-Ready.pdf | 2022-08-12 05:34 | 43M | |
| Final ANNUAL REPORT 2020-21.pdf | 2022-08-31 07:41 | 43M | |
| Download-PHRD-Hindi-Print-Ready.pdf | 2022-08-12 05:34 | 44M | |
| MCI_Certificates_Final.pdf | 2020-01-23 09:57 | 59M | |
| trading in the zone - one page per sheet ( PDFDrive ).mobi | 2022-12-04 04:58 | 88M | |
| MGMIHS (Annual Report 2017 - 18) Final Book.pdf | 2020-02-28 09:27 | 106M | |
| Final ANNUAL REPORT 2019-20.pdf | 2022-03-24 08:56 | 120M | |
| MGM Institute (Annual Report) Book PDF 1 (FINAL)_compressed.pdf | 2019-11-11 10:10 | 178M | |
![[ ]](/icons/compressed.gif) | smallFolders.zip | 2024-09-05 20:14 | 2.5G | |
|
|---|